C14H20FNS — CID 66054051
1-(2-fluorophenyl)sulfanyl-N-methylhept-6-en-2-amine (PubChem CID 66054051) has the molecular formula C14H20FNS and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfanyl-N-methylhept-6-en-2-amine.
| Compound Name | 1-(2-fluorophenyl)sulfanyl-N-methylhept-6-en-2-amine |
|---|---|
| PubChem CID | 66054051 |
| Molecular Formula | C14H20FNS |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-(2-fluorophenyl)sulfanyl-N-methylhept-6-en-2-amine |
| SMILES | C=CCCCC(CSc1ccccc1F)NC |
| InChI | InChI=1S/C14H20FNS/c1-3-4-5-8-12(16-2)11-17-14-10-7-6-9-13(14)15/h3,6-7,9-10,12,16H,1,4-5,8,11H2,2H3 |
| InChIKey | PRCLMXIDEVCIDH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|