C13H18FNS — CID 66052111
1-(2-fluorophenyl)sulfanylhept-6-en-2-amine (PubChem CID 66052111) has the molecular formula C13H18FNS and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfanylhept-6-en-2-amine.
| Compound Name | 1-(2-fluorophenyl)sulfanylhept-6-en-2-amine |
|---|---|
| PubChem CID | 66052111 |
| Molecular Formula | C13H18FNS |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-(2-fluorophenyl)sulfanylhept-6-en-2-amine |
| SMILES | C=CCCCC(N)CSc1ccccc1F |
| InChI | InChI=1S/C13H18FNS/c1-2-3-4-7-11(15)10-16-13-9-6-5-8-12(13)14/h2,5-6,8-9,11H,1,3-4,7,10,15H2 |
| InChIKey | RGIZQTXVXYXPPC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|