C11H14FNS — CID 66053663
1-(2-fluorophenyl)sulfanyl-N-methylbut-3-en-2-amine (PubChem CID 66053663) has the molecular formula C11H14FNS and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfanyl-N-methylbut-3-en-2-amine.
| Compound Name | 1-(2-fluorophenyl)sulfanyl-N-methylbut-3-en-2-amine |
|---|---|
| PubChem CID | 66053663 |
| Molecular Formula | C11H14FNS |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(2-fluorophenyl)sulfanyl-N-methylbut-3-en-2-amine |
| SMILES | C=CC(CSc1ccccc1F)NC |
| InChI | InChI=1S/C11H14FNS/c1-3-9(13-2)8-14-11-7-5-4-6-10(11)12/h3-7,9,13H,1,8H2,2H3 |
| InChIKey | VLBHUZQXAFOTRG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|