C12H16FIN2O — CID 66100285
4-fluoro-5-iodo-2-N-methyl-2-N-(oxolan-2-ylmethyl)benzene-1,2-diamine (PubChem CID 66100285) has the molecular formula C12H16FIN2O and a molecular weight of 350.18 g/mol. Its IUPAC name is 4-fluoro-5-iodo-2-N-methyl-2-N-(oxolan-2-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-iodo-2-N-methyl-2-N-(oxolan-2-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 66100285 |
| Molecular Formula | C12H16FIN2O |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 4-fluoro-5-iodo-2-N-methyl-2-N-(oxolan-2-ylmethyl)benzene-1,2-diamine |
| SMILES | CN(CC1CCCO1)c1cc(F)c(I)cc1N |
| InChI | InChI=1S/C12H16FIN2O/c1-16(7-8-3-2-4-17-8)12-5-9(13)10(14)6-11(12)15/h5-6,8H,2-4,7,15H2,1H3 |
| InChIKey | NXNSMKSELBFNNY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|