C12H20BrNOS2 — CID 66103542
3-[2-amino-1-(4-bromothiophen-2-yl)butyl]sulfanyl-2-methylpropan-1-ol (PubChem CID 66103542) has the molecular formula C12H20BrNOS2 and a molecular weight of 338.34 g/mol. Its IUPAC name is 3-[2-amino-1-(4-bromothiophen-2-yl)butyl]sulfanyl-2-methylpropan-1-ol.
| Compound Name | 3-[2-amino-1-(4-bromothiophen-2-yl)butyl]sulfanyl-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 66103542 |
| Molecular Formula | C12H20BrNOS2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-[2-amino-1-(4-bromothiophen-2-yl)butyl]sulfanyl-2-methylpropan-1-ol |
| SMILES | CCC(N)C(SCC(C)CO)c1cc(Br)cs1 |
| InChI | InChI=1S/C12H20BrNOS2/c1-3-10(14)12(17-6-8(2)5-15)11-4-9(13)7-16-11/h4,7-8,10,12,15H,3,5-6,14H2,1-2H3 |
| InChIKey | MVKZICLJYMVEKS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |