C11H17NOS — CID 66103746
3-(4-amino-3-methylphenyl)sulfanyl-2-methylpropan-1-ol (PubChem CID 66103746) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 3-(4-amino-3-methylphenyl)sulfanyl-2-methylpropan-1-ol.
| Compound Name | 3-(4-amino-3-methylphenyl)sulfanyl-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 66103746 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-(4-amino-3-methylphenyl)sulfanyl-2-methylpropan-1-ol |
| SMILES | Cc1cc(SCC(C)CO)ccc1N |
| InChI | InChI=1S/C11H17NOS/c1-8(6-13)7-14-10-3-4-11(12)9(2)5-10/h3-5,8,13H,6-7,12H2,1-2H3 |
| InChIKey | AIAUWDFRRDUSDV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|