C10H12F3NOS — CID 79147662
3-(4-amino-3-methylphenyl)sulfanyl-1,1,1-trifluoropropan-2-ol (PubChem CID 79147662) has the molecular formula C10H12F3NOS and a molecular weight of 251.27 g/mol. Its IUPAC name is 3-(4-amino-3-methylphenyl)sulfanyl-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(4-amino-3-methylphenyl)sulfanyl-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 79147662 |
| Molecular Formula | C10H12F3NOS |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-(4-amino-3-methylphenyl)sulfanyl-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1cc(SCC(O)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C10H12F3NOS/c1-6-4-7(2-3-8(6)14)16-5-9(15)10(11,12)13/h2-4,9,15H,5,14H2,1H3 |
| InChIKey | RBFHETIXKVXKSP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|