C9H19N3O3 — CID 66106637
2-(carbamoylamino)-N-(4-hydroxy-2-methylbutyl)propanamide (PubChem CID 66106637) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-(4-hydroxy-2-methylbutyl)propanamide.
| Compound Name | 2-(carbamoylamino)-N-(4-hydroxy-2-methylbutyl)propanamide |
|---|---|
| PubChem CID | 66106637 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 2-(carbamoylamino)-N-(4-hydroxy-2-methylbutyl)propanamide |
| SMILES | CC(CCO)CNC(=O)C(C)NC(N)=O |
| InChI | InChI=1S/C9H19N3O3/c1-6(3-4-13)5-11-8(14)7(2)12-9(10)15/h6-7,13H,3-5H2,1-2H3,(H,11,14)(H3,10,12,15) |
| InChIKey | JELKCTSXJLPDOE-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |