C12H17NO2 — CID 66107844
4,5,5-trimethyl-4-(5-methylfuran-2-yl)pyrrolidin-2-one (PubChem CID 66107844) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4,5,5-trimethyl-4-(5-methylfuran-2-yl)pyrrolidin-2-one.
| Compound Name | 4,5,5-trimethyl-4-(5-methylfuran-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 66107844 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4,5,5-trimethyl-4-(5-methylfuran-2-yl)pyrrolidin-2-one |
| SMILES | Cc1ccc(C2(C)CC(=O)NC2(C)C)o1 |
| InChI | InChI=1S/C12H17NO2/c1-8-5-6-9(15-8)12(4)7-10(14)13-11(12,2)3/h5-6H,7H2,1-4H3,(H,13,14) |
| InChIKey | ORPZFPUHAPPDJK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |