C14H18N2O4S — CID 66115028
3-[(1-ethylindazol-3-yl)methylsulfonyl]butanoic acid (PubChem CID 66115028) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-[(1-ethylindazol-3-yl)methylsulfonyl]butanoic acid.
| Compound Name | 3-[(1-ethylindazol-3-yl)methylsulfonyl]butanoic acid |
|---|---|
| PubChem CID | 66115028 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-[(1-ethylindazol-3-yl)methylsulfonyl]butanoic acid |
| SMILES | CCn1nc(CS(=O)(=O)C(C)CC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O4S/c1-3-16-13-7-5-4-6-11(13)12(15-16)9-21(19,20)10(2)8-14(17)18/h4-7,10H,3,8-9H2,1-2H3,(H,17,18) |
| InChIKey | GLCBHYPRHQBJKT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |