C14H18N2O3S — CID 81227822
2-[(1-ethylindazol-3-yl)methylsulfinyl]-2-methylpropanoic acid (PubChem CID 81227822) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-[(1-ethylindazol-3-yl)methylsulfinyl]-2-methylpropanoic acid.
| Compound Name | 2-[(1-ethylindazol-3-yl)methylsulfinyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 81227822 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(1-ethylindazol-3-yl)methylsulfinyl]-2-methylpropanoic acid |
| SMILES | CCn1nc(CS(=O)C(C)(C)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O3S/c1-4-16-12-8-6-5-7-10(12)11(15-16)9-20(19)14(2,3)13(17)18/h5-8H,4,9H2,1-3H3,(H,17,18) |
| InChIKey | URXJFHFSHSPAEG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |