C14H18N4O — CID 66118950
N,3-dimethyl-4-[(3-methylimidazol-4-yl)methylamino]benzamide (PubChem CID 66118950) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N,3-dimethyl-4-[(3-methylimidazol-4-yl)methylamino]benzamide.
| Compound Name | N,3-dimethyl-4-[(3-methylimidazol-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 66118950 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N,3-dimethyl-4-[(3-methylimidazol-4-yl)methylamino]benzamide |
| SMILES | CNC(=O)c1ccc(NCc2cncn2C)c(C)c1 |
| InChI | InChI=1S/C14H18N4O/c1-10-6-11(14(19)15-2)4-5-13(10)17-8-12-7-16-9-18(12)3/h4-7,9,17H,8H2,1-3H3,(H,15,19) |
| InChIKey | DDRMHBLPDWZPCR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |