C11H16N4O — CID 66119658
[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]methanamine (PubChem CID 66119658) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is [5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]methanamine.
| Compound Name | [5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 66119658 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]methanamine |
| SMILES | CCc1cc(-c2cnc(CN)o2)n(CC)n1 |
| InChI | InChI=1S/C11H16N4O/c1-3-8-5-9(15(4-2)14-8)10-7-13-11(6-12)16-10/h5,7H,3-4,6,12H2,1-2H3 |
| InChIKey | YOBUXKNZGUMZJJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |