C12H18N4O — CID 66119659
1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 66119659) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 66119659 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | CCc1cc(-c2cnc(C(C)N)o2)n(CC)n1 |
| InChI | InChI=1S/C12H18N4O/c1-4-9-6-10(16(5-2)15-9)11-7-14-12(17-11)8(3)13/h6-8H,4-5,13H2,1-3H3 |
| InChIKey | MZRFZSDZZACWNV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |