About 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine
1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 66119659) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine |
| PubChem CID | 66119659 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | CCc1cc(-c2cnc(C(C)N)o2)n(CC)n1 |
| InChI | InChI=1S/C12H18N4O/c1-4-9-6-10(16(5-2)15-9)11-7-14-12(17-11)8(3)13/h6-8H,4-5,13H2,1-3H3 |
| InChIKey | MZRFZSDZZACWNV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine?
The IUPAC name of 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine (CID 66119659) is 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine.
What is the SMILES notation for 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine?
The canonical SMILES for 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine is CCc1cc(-c2cnc(C(C)N)o2)n(CC)n1.
What is the InChIKey of 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine?
The InChIKey is MZRFZSDZZACWNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O/c1-4-9-6-10(16(5-2)15-9)11-7-14-12(17-11)8(3)13/h6-8H,4-5,13H2,1-3H3.
What are the key properties of 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine?
1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine has a molecular weight of 234.30 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(1,3-diethylpyrazol-5-yl)-1,3-oxazol-2-yl]ethanamine is sourced from PubChem (CID 66119659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).