C12H14ClN3O3S2 — CID 66119937
5-[[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]methyl]thiophene-2-sulfonyl chloride (PubChem CID 66119937) has the molecular formula C12H14ClN3O3S2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 5-[[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]methyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]methyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 66119937 |
| Molecular Formula | C12H14ClN3O3S2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 5-[[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]methyl]thiophene-2-sulfonyl chloride |
| SMILES | CCc1cc(C(=O)NCc2ccc(S(=O)(=O)Cl)s2)n(C)n1 |
| InChI | InChI=1S/C12H14ClN3O3S2/c1-3-8-6-10(16(2)15-8)12(17)14-7-9-4-5-11(20-9)21(13,18)19/h4-6H,3,7H2,1-2H3,(H,14,17) |
| InChIKey | GPAUIHNIJLROIZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |