C12H18N6O — CID 66123130
4-amino-1-ethyl-3-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazole-5-carboxamide (PubChem CID 66123130) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is 4-amino-1-ethyl-3-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazole-5-carboxamide.
| Compound Name | 4-amino-1-ethyl-3-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66123130 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-amino-1-ethyl-3-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazole-5-carboxamide |
| SMILES | CCn1nc(C)c(N)c1C(=O)NCc1ccnn1C |
| InChI | InChI=1S/C12H18N6O/c1-4-18-11(10(13)8(2)16-18)12(19)14-7-9-5-6-15-17(9)3/h5-6H,4,7,13H2,1-3H3,(H,14,19) |
| InChIKey | UJPVXZXEZILXSE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |