C11H16F3N3O3 — CID 66125001
3-(2,2,2-trifluoroethoxy)propyl 4-amino-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 66125001) has the molecular formula C11H16F3N3O3 and a molecular weight of 295.26 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethoxy)propyl 4-amino-1,3-dimethylpyrazole-5-carboxylate.
| Compound Name | 3-(2,2,2-trifluoroethoxy)propyl 4-amino-1,3-dimethylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 66125001 |
| Molecular Formula | C11H16F3N3O3 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-(2,2,2-trifluoroethoxy)propyl 4-amino-1,3-dimethylpyrazole-5-carboxylate |
| SMILES | Cc1nn(C)c(C(=O)OCCCOCC(F)(F)F)c1N |
| InChI | InChI=1S/C11H16F3N3O3/c1-7-8(15)9(17(2)16-7)10(18)20-5-3-4-19-6-11(12,13)14/h3-6,15H2,1-2H3 |
| InChIKey | XKNIMZFMJBHPRI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|