C12H12F2N4O — CID 66126880
N-(5-amino-2,4-difluorophenyl)-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 66126880) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is N-(5-amino-2,4-difluorophenyl)-2,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-(5-amino-2,4-difluorophenyl)-2,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 66126880 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | N-(5-amino-2,4-difluorophenyl)-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(N)c(F)cc2F)n(C)n1 |
| InChI | InChI=1S/C12H12F2N4O/c1-6-3-11(18(2)17-6)12(19)16-10-5-9(15)7(13)4-8(10)14/h3-5H,15H2,1-2H3,(H,16,19) |
| InChIKey | UOBQNLFKIHLTAP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|