C30H35Br2NO3 — CID 6613027
5-[[1-[(2-bromophenyl)methoxy]-3-phenylpropan-2-yl]-[(2-bromophenyl)methyl]amino]pentyl acetate (PubChem CID 6613027) has the molecular formula C30H35Br2NO3 and a molecular weight of 617.42 g/mol. Its IUPAC name is 5-[[1-[(2-bromophenyl)methoxy]-3-phenylpropan-2-yl]-[(2-bromophenyl)methyl]amino]pentyl acetate.
| Compound Name | 5-[[1-[(2-bromophenyl)methoxy]-3-phenylpropan-2-yl]-[(2-bromophenyl)methyl]amino]pentyl acetate |
|---|---|
| PubChem CID | 6613027 |
| Molecular Formula | C30H35Br2NO3 |
| Molecular Weight | 617.42 g/mol |
| Exact Mass | 615.10 |
| IUPAC Name | 5-[[1-[(2-bromophenyl)methoxy]-3-phenylpropan-2-yl]-[(2-bromophenyl)methyl]amino]pentyl acetate |
| SMILES | CC(=O)OCCCCCN(Cc1ccccc1Br)C(COCc1ccccc1Br)Cc1ccccc1 |
| InChI | InChI=1S/C30H35Br2NO3/c1-24(34)36-19-11-3-10-18-33(21-26-14-6-8-16-29(26)31)28(20-25-12-4-2-5-13-25)23-35-22-27-15-7-9-17-30(27)32/h2,4-9,12-17,28H,3,10-11,18-23H2,1H3 |
| InChIKey | MTJQTCUXMYRSDI-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.42 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|