C13H23N3O2 — CID 66130342
methyl (2S)-3-methyl-2-[(3-propylimidazol-4-yl)methylamino]butanoate (PubChem CID 66130342) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[(3-propylimidazol-4-yl)methylamino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[(3-propylimidazol-4-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 66130342 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | methyl (2S)-3-methyl-2-[(3-propylimidazol-4-yl)methylamino]butanoate |
| SMILES | CCCn1cncc1CN[C@H](C(=O)OC)C(C)C |
| InChI | InChI=1S/C13H23N3O2/c1-5-6-16-9-14-7-11(16)8-15-12(10(2)3)13(17)18-4/h7,9-10,12,15H,5-6,8H2,1-4H3/t12-/m0/s1 |
| InChIKey | PBDWHFVMIZEOON-LBPRGKRZSA-N |
| XLogP | 1.58 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |