C12H20N2O2S — CID 66152824
methyl 2-methyl-3-[(3-propylimidazol-4-yl)methylsulfanyl]propanoate (PubChem CID 66152824) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is methyl 2-methyl-3-[(3-propylimidazol-4-yl)methylsulfanyl]propanoate.
| Compound Name | methyl 2-methyl-3-[(3-propylimidazol-4-yl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 66152824 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | methyl 2-methyl-3-[(3-propylimidazol-4-yl)methylsulfanyl]propanoate |
| SMILES | CCCn1cncc1CSCC(C)C(=O)OC |
| InChI | InChI=1S/C12H20N2O2S/c1-4-5-14-9-13-6-11(14)8-17-7-10(2)12(15)16-3/h6,9-10H,4-5,7-8H2,1-3H3 |
| InChIKey | KSFSRZRXPQSYOB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |