C20H29NO4 — CID 6613210
N-(6-hydroxy-6-methylheptan-2-yl)-3-(7-methoxy-1-benzofuran-5-yl)propanamide (PubChem CID 6613210) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-(6-hydroxy-6-methylheptan-2-yl)-3-(7-methoxy-1-benzofuran-5-yl)propanamide.
| Compound Name | N-(6-hydroxy-6-methylheptan-2-yl)-3-(7-methoxy-1-benzofuran-5-yl)propanamide |
|---|---|
| PubChem CID | 6613210 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-(6-hydroxy-6-methylheptan-2-yl)-3-(7-methoxy-1-benzofuran-5-yl)propanamide |
| SMILES | COc1cc(CCC(=O)NC(C)CCCC(C)(C)O)cc2ccoc12 |
| InChI | InChI=1S/C20H29NO4/c1-14(6-5-10-20(2,3)23)21-18(22)8-7-15-12-16-9-11-25-19(16)17(13-15)24-4/h9,11-14,23H,5-8,10H2,1-4H3,(H,21,22) |
| InChIKey | LOAHFDMVJRKQQI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |