C16H17ClINS — CID 66139977
1-(2-chlorophenyl)sulfanyl-3-(4-iodophenyl)-N-methylpropan-2-amine (PubChem CID 66139977) has the molecular formula C16H17ClINS and a molecular weight of 417.74 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfanyl-3-(4-iodophenyl)-N-methylpropan-2-amine.
| Compound Name | 1-(2-chlorophenyl)sulfanyl-3-(4-iodophenyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 66139977 |
| Molecular Formula | C16H17ClINS |
| Molecular Weight | 417.74 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | 1-(2-chlorophenyl)sulfanyl-3-(4-iodophenyl)-N-methylpropan-2-amine |
| SMILES | CNC(CSc1ccccc1Cl)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C16H17ClINS/c1-19-14(10-12-6-8-13(18)9-7-12)11-20-16-5-3-2-4-15(16)17/h2-9,14,19H,10-11H2,1H3 |
| InChIKey | AFLWBVOJKLAXFW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.74 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|