C15H22BrNS — CID 66142568
[1-(3-bromophenyl)sulfanyl-3,3-diethylcyclobutyl]methanamine (PubChem CID 66142568) has the molecular formula C15H22BrNS and a molecular weight of 328.32 g/mol. Its IUPAC name is [1-(3-bromophenyl)sulfanyl-3,3-diethylcyclobutyl]methanamine.
| Compound Name | [1-(3-bromophenyl)sulfanyl-3,3-diethylcyclobutyl]methanamine |
|---|---|
| PubChem CID | 66142568 |
| Molecular Formula | C15H22BrNS |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | [1-(3-bromophenyl)sulfanyl-3,3-diethylcyclobutyl]methanamine |
| SMILES | CCC1(CC)CC(CN)(Sc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C15H22BrNS/c1-3-14(4-2)9-15(10-14,11-17)18-13-7-5-6-12(16)8-13/h5-8H,3-4,9-11,17H2,1-2H3 |
| InChIKey | GZOSTDJQZRITHM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |