C14H12Cl2N2S — CID 66147650
4-chloro-2-[(3-chlorophenyl)sulfanylmethyl]-6-cyclopropylpyrimidine (PubChem CID 66147650) has the molecular formula C14H12Cl2N2S and a molecular weight of 311.24 g/mol. Its IUPAC name is 4-chloro-2-[(3-chlorophenyl)sulfanylmethyl]-6-cyclopropylpyrimidine.
| Compound Name | 4-chloro-2-[(3-chlorophenyl)sulfanylmethyl]-6-cyclopropylpyrimidine |
|---|---|
| PubChem CID | 66147650 |
| Molecular Formula | C14H12Cl2N2S |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 4-chloro-2-[(3-chlorophenyl)sulfanylmethyl]-6-cyclopropylpyrimidine |
| SMILES | Clc1cccc(SCc2nc(Cl)cc(C3CC3)n2)c1 |
| InChI | InChI=1S/C14H12Cl2N2S/c15-10-2-1-3-11(6-10)19-8-14-17-12(9-4-5-9)7-13(16)18-14/h1-3,6-7,9H,4-5,8H2 |
| InChIKey | FQLHAIYWFCQOBX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |