C12H8Cl3NS — CID 63539043
3,6-dichloro-2-[(3-chlorophenyl)sulfanylmethyl]pyridine (PubChem CID 63539043) has the molecular formula C12H8Cl3NS and a molecular weight of 304.63 g/mol. Its IUPAC name is 3,6-dichloro-2-[(3-chlorophenyl)sulfanylmethyl]pyridine.
| Compound Name | 3,6-dichloro-2-[(3-chlorophenyl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 63539043 |
| Molecular Formula | C12H8Cl3NS |
| Molecular Weight | 304.63 g/mol |
| Exact Mass | 302.94 |
| IUPAC Name | 3,6-dichloro-2-[(3-chlorophenyl)sulfanylmethyl]pyridine |
| SMILES | Clc1cccc(SCc2nc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C12H8Cl3NS/c13-8-2-1-3-9(6-8)17-7-11-10(14)4-5-12(15)16-11/h1-6H,7H2 |
| InChIKey | DKVLCPRWBYAAPU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.63 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|