C13H11Cl2NS — CID 62884951
3,6-dichloro-2-[(2-methylphenyl)sulfanylmethyl]pyridine (PubChem CID 62884951) has the molecular formula C13H11Cl2NS and a molecular weight of 284.21 g/mol. Its IUPAC name is 3,6-dichloro-2-[(2-methylphenyl)sulfanylmethyl]pyridine.
| Compound Name | 3,6-dichloro-2-[(2-methylphenyl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 62884951 |
| Molecular Formula | C13H11Cl2NS |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 3,6-dichloro-2-[(2-methylphenyl)sulfanylmethyl]pyridine |
| SMILES | Cc1ccccc1SCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H11Cl2NS/c1-9-4-2-3-5-12(9)17-8-11-10(14)6-7-13(15)16-11/h2-7H,8H2,1H3 |
| InChIKey | WTWRQFSNZHDTFV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|