C12H9Cl2NOS — CID 55127535
4-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]phenol (PubChem CID 55127535) has the molecular formula C12H9Cl2NOS and a molecular weight of 286.18 g/mol. Its IUPAC name is 4-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]phenol.
| Compound Name | 4-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]phenol |
|---|---|
| PubChem CID | 55127535 |
| Molecular Formula | C12H9Cl2NOS |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 4-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]phenol |
| SMILES | Oc1ccc(SCc2nc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C12H9Cl2NOS/c13-10-5-6-12(14)15-11(10)7-17-9-3-1-8(16)2-4-9/h1-6,16H,7H2 |
| InChIKey | AOTXJAMQNNIDBV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|