C8H14N2O2S — CID 66147810
3-(2-ethoxyethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione (PubChem CID 66147810) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione.
| Compound Name | 3-(2-ethoxyethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 66147810 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3-(2-ethoxyethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
| SMILES | CCOCCn1c(CO)c[nH]c1=S |
| InChI | InChI=1S/C8H14N2O2S/c1-2-12-4-3-10-7(6-11)5-9-8(10)13/h5,11H,2-4,6H2,1H3,(H,9,13) |
| InChIKey | KWCGNFYMTLBPIS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|