C9H12ClN5 — CID 66151462
3-[1-[5-(chloromethyl)imidazol-1-yl]ethyl]-4-methyl-1,2,4-triazole (PubChem CID 66151462) has the molecular formula C9H12ClN5 and a molecular weight of 225.68 g/mol. Its IUPAC name is 3-[1-[5-(chloromethyl)imidazol-1-yl]ethyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[1-[5-(chloromethyl)imidazol-1-yl]ethyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 66151462 |
| Molecular Formula | C9H12ClN5 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-[1-[5-(chloromethyl)imidazol-1-yl]ethyl]-4-methyl-1,2,4-triazole |
| SMILES | CC(c1nncn1C)n1cncc1CCl |
| InChI | InChI=1S/C9H12ClN5/c1-7(9-13-12-6-14(9)2)15-5-11-4-8(15)3-10/h4-7H,3H2,1-2H3 |
| InChIKey | XHSFUOGIRQSBAP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|