C16H22BrClN2 — CID 66156264
1-[(2-bromo-5-chlorophenyl)methyl]-3-pyrrolidin-2-ylpiperidine (PubChem CID 66156264) has the molecular formula C16H22BrClN2 and a molecular weight of 357.72 g/mol. Its IUPAC name is 1-[(2-bromo-5-chlorophenyl)methyl]-3-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-[(2-bromo-5-chlorophenyl)methyl]-3-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 66156264 |
| Molecular Formula | C16H22BrClN2 |
| Molecular Weight | 357.72 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1-[(2-bromo-5-chlorophenyl)methyl]-3-pyrrolidin-2-ylpiperidine |
| SMILES | Clc1ccc(Br)c(CN2CCCC(C3CCCN3)C2)c1 |
| InChI | InChI=1S/C16H22BrClN2/c17-15-6-5-14(18)9-13(15)11-20-8-2-3-12(10-20)16-4-1-7-19-16/h5-6,9,12,16,19H,1-4,7-8,10-11H2 |
| InChIKey | PDTSUKLJRDKIFE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |