C16H16BrCl2N — CID 66159290
N-[(2-bromo-5-chlorophenyl)methyl]-1-(4-chlorophenyl)propan-2-amine (PubChem CID 66159290) has the molecular formula C16H16BrCl2N and a molecular weight of 373.12 g/mol. Its IUPAC name is N-[(2-bromo-5-chlorophenyl)methyl]-1-(4-chlorophenyl)propan-2-amine.
| Compound Name | N-[(2-bromo-5-chlorophenyl)methyl]-1-(4-chlorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 66159290 |
| Molecular Formula | C16H16BrCl2N |
| Molecular Weight | 373.12 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | N-[(2-bromo-5-chlorophenyl)methyl]-1-(4-chlorophenyl)propan-2-amine |
| SMILES | CC(Cc1ccc(Cl)cc1)NCc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C16H16BrCl2N/c1-11(8-12-2-4-14(18)5-3-12)20-10-13-9-15(19)6-7-16(13)17/h2-7,9,11,20H,8,10H2,1H3 |
| InChIKey | RIJWVFUUZIBTSS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.12 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |