C17H19BrClN — CID 66159883
N-[(2-bromo-5-chlorophenyl)methyl]-2-methyl-1-phenylpropan-1-amine (PubChem CID 66159883) has the molecular formula C17H19BrClN and a molecular weight of 352.70 g/mol. Its IUPAC name is N-[(2-bromo-5-chlorophenyl)methyl]-2-methyl-1-phenylpropan-1-amine.
| Compound Name | N-[(2-bromo-5-chlorophenyl)methyl]-2-methyl-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 66159883 |
| Molecular Formula | C17H19BrClN |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[(2-bromo-5-chlorophenyl)methyl]-2-methyl-1-phenylpropan-1-amine |
| SMILES | CC(C)C(NCc1cc(Cl)ccc1Br)c1ccccc1 |
| InChI | InChI=1S/C17H19BrClN/c1-12(2)17(13-6-4-3-5-7-13)20-11-14-10-15(19)8-9-16(14)18/h3-10,12,17,20H,11H2,1-2H3 |
| InChIKey | BCSHLOOAUGDPDH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |