C17H19BrO2S — CID 66159989
2-(3-bromophenyl)sulfanyl-1-(4-propoxyphenyl)ethanol (PubChem CID 66159989) has the molecular formula C17H19BrO2S and a molecular weight of 367.31 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-1-(4-propoxyphenyl)ethanol.
| Compound Name | 2-(3-bromophenyl)sulfanyl-1-(4-propoxyphenyl)ethanol |
|---|---|
| PubChem CID | 66159989 |
| Molecular Formula | C17H19BrO2S |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-1-(4-propoxyphenyl)ethanol |
| SMILES | CCCOc1ccc(C(O)CSc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C17H19BrO2S/c1-2-10-20-15-8-6-13(7-9-15)17(19)12-21-16-5-3-4-14(18)11-16/h3-9,11,17,19H,2,10,12H2,1H3 |
| InChIKey | LXXZCEWAULYUQA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |