C9H16N2O5 — CID 66165537
2-hydroxy-3-(1,4-oxazepane-4-carbonylamino)propanoic acid (PubChem CID 66165537) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-hydroxy-3-(1,4-oxazepane-4-carbonylamino)propanoic acid.
| Compound Name | 2-hydroxy-3-(1,4-oxazepane-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 66165537 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-hydroxy-3-(1,4-oxazepane-4-carbonylamino)propanoic acid |
| SMILES | O=C(O)C(O)CNC(=O)N1CCCOCC1 |
| InChI | InChI=1S/C9H16N2O5/c12-7(8(13)14)6-10-9(15)11-2-1-4-16-5-3-11/h7,12H,1-6H2,(H,10,15)(H,13,14) |
| InChIKey | PGCBOUJPHOZIST-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |