C11H18N2O6S — CID 66167023
2-hydroxy-3-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]propanoic acid (PubChem CID 66167023) has the molecular formula C11H18N2O6S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]propanoic acid.
| Compound Name | 2-hydroxy-3-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66167023 |
| Molecular Formula | C11H18N2O6S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-hydroxy-3-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]propanoic acid |
| SMILES | O=C(CSCC(=O)N1CCOCC1)NCC(O)C(=O)O |
| InChI | InChI=1S/C11H18N2O6S/c14-8(11(17)18)5-12-9(15)6-20-7-10(16)13-1-3-19-4-2-13/h8,14H,1-7H2,(H,12,15)(H,17,18) |
| InChIKey | RMNRXKMRZYBJQX-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |