C12H20N2O6S — CID 66173764
2-hydroxy-2-methyl-3-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]propanoic acid (PubChem CID 66173764) has the molecular formula C12H20N2O6S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66173764 |
| Molecular Formula | C12H20N2O6S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-hydroxy-2-methyl-3-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]propanoic acid |
| SMILES | CC(O)(CNC(=O)CSCC(=O)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C12H20N2O6S/c1-12(19,11(17)18)8-13-9(15)6-21-7-10(16)14-2-4-20-5-3-14/h19H,2-8H2,1H3,(H,13,15)(H,17,18) |
| InChIKey | ZPASPEJYNXLHQN-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |