C8H13F3N2O5 — CID 66166963
2-hydroxy-3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]propanoic acid (PubChem CID 66166963) has the molecular formula C8H13F3N2O5 and a molecular weight of 274.19 g/mol. Its IUPAC name is 2-hydroxy-3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]propanoic acid.
| Compound Name | 2-hydroxy-3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 66166963 |
| Molecular Formula | C8H13F3N2O5 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-hydroxy-3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]propanoic acid |
| SMILES | O=C(NCCOCC(F)(F)F)NCC(O)C(=O)O |
| InChI | InChI=1S/C8H13F3N2O5/c9-8(10,11)4-18-2-1-12-7(17)13-3-5(14)6(15)16/h5,14H,1-4H2,(H,15,16)(H2,12,13,17) |
| InChIKey | PHMXWSGOWQPLFY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|