C11H21N3O5 — CID 66167159
3-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-2-hydroxypropanoic acid (PubChem CID 66167159) has the molecular formula C11H21N3O5 and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66167159 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-2-hydroxypropanoic acid |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)NCC(O)C(=O)O |
| InChI | InChI=1S/C11H21N3O5/c1-4-14(5-2)9(16)7-13(3)11(19)12-6-8(15)10(17)18/h8,15H,4-7H2,1-3H3,(H,12,19)(H,17,18) |
| InChIKey | CFVAWKDKTILBGX-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |