About 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid
3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid (PubChem CID 66167715) has the molecular formula C8H13N3O5S
and a molecular weight of 263.27 g/mol. Its IUPAC name is 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid |
| PubChem CID | 66167715 |
| Molecular Formula | C8H13N3O5S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid |
| SMILES | Cc1nc(S(=O)(=O)NCC(O)C(=O)O)cn1C |
| InChI | InChI=1S/C8H13N3O5S/c1-5-10-7(4-11(5)2)17(15,16)9-3-6(12)8(13)14/h4,6,9,12H,3H2,1-2H3,(H,13,14) |
| InChIKey | DINNWYZRNKSVLQ-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid?
The IUPAC name of 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid (CID 66167715) is 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid.
What is the SMILES notation for 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid?
The canonical SMILES for 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid is Cc1nc(S(=O)(=O)NCC(O)C(=O)O)cn1C.
What is the InChIKey of 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid?
The InChIKey is DINNWYZRNKSVLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O5S/c1-5-10-7(4-11(5)2)17(15,16)9-3-6(12)8(13)14/h4,6,9,12H,3H2,1-2H3,(H,13,14).
What are the key properties of 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid?
3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid has a molecular weight of 263.27 g/mol, XLogP of -1.55, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]-2-hydroxypropanoic acid is sourced from PubChem (CID 66167715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).