C11H15ClN2O3 — CID 66171426
N-(3-chlorophenyl)-2-(2,3-dihydroxypropylamino)acetamide (PubChem CID 66171426) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(2,3-dihydroxypropylamino)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(2,3-dihydroxypropylamino)acetamide |
|---|---|
| PubChem CID | 66171426 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(3-chlorophenyl)-2-(2,3-dihydroxypropylamino)acetamide |
| SMILES | O=C(CNCC(O)CO)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O3/c12-8-2-1-3-9(4-8)14-11(17)6-13-5-10(16)7-15/h1-4,10,13,15-16H,5-7H2,(H,14,17) |
| InChIKey | QUJJRPQDQJKTIM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |