C10H17N3O2 — CID 66174808
3-[(6-ethyl-2-methylpyrimidin-4-yl)amino]propane-1,2-diol (PubChem CID 66174808) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-[(6-ethyl-2-methylpyrimidin-4-yl)amino]propane-1,2-diol.
| Compound Name | 3-[(6-ethyl-2-methylpyrimidin-4-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 66174808 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-[(6-ethyl-2-methylpyrimidin-4-yl)amino]propane-1,2-diol |
| SMILES | CCc1cc(NCC(O)CO)nc(C)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-3-8-4-10(13-7(2)12-8)11-5-9(15)6-14/h4,9,14-15H,3,5-6H2,1-2H3,(H,11,12,13) |
| InChIKey | ZESHJLVALYKBFM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |