C15H16F3N3O2 — CID 10426567
3-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]propane-1,2-diol (PubChem CID 10426567) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 3-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]propane-1,2-diol.
| Compound Name | 3-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 10426567 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 3-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]propane-1,2-diol |
| SMILES | CCc1cc(NCC(O)CO)nc(-c2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C15H16F3N3O2/c1-2-9-5-13(19-6-10(23)7-22)21-15(20-9)8-3-11(16)14(18)12(17)4-8/h3-5,10,22-23H,2,6-7H2,1H3,(H,19,20,21) |
| InChIKey | FVZGHUCSRNBWCR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|