About 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid
3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66175544) has the molecular formula C11H19N3O5
and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid |
| PubChem CID | 66175544 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNC(=O)N1CCNC(=O)C1(C)C)C(=O)O |
| InChI | InChI=1S/C11H19N3O5/c1-10(2)7(15)12-4-5-14(10)9(18)13-6-11(3,19)8(16)17/h19H,4-6H2,1-3H3,(H,12,15)(H,13,18)(H,16,17) |
| InChIKey | UCXLELSEANRHSQ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid?
The IUPAC name of 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid (CID 66175544) is 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid.
What is the SMILES notation for 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid?
The canonical SMILES for 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid is CC(O)(CNC(=O)N1CCNC(=O)C1(C)C)C(=O)O.
What is the InChIKey of 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid?
The InChIKey is UCXLELSEANRHSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O5/c1-10(2)7(15)12-4-5-14(10)9(18)13-6-11(3,19)8(16)17/h19H,4-6H2,1-3H3,(H,12,15)(H,13,18)(H,16,17).
What are the key properties of 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid?
3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid has a molecular weight of 273.29 g/mol, XLogP of -1.26, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-dimethyl-3-oxopiperazine-1-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid is sourced from PubChem (CID 66175544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).