C15H25NO2 — CID 66176548
3-(1-phenylhexylamino)propane-1,2-diol (PubChem CID 66176548) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-(1-phenylhexylamino)propane-1,2-diol.
| Compound Name | 3-(1-phenylhexylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 66176548 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 3-(1-phenylhexylamino)propane-1,2-diol |
| SMILES | CCCCCC(NCC(O)CO)c1ccccc1 |
| InChI | InChI=1S/C15H25NO2/c1-2-3-5-10-15(16-11-14(18)12-17)13-8-6-4-7-9-13/h4,6-9,14-18H,2-3,5,10-12H2,1H3 |
| InChIKey | AFFHZSFHBRYSTD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|