C12H15FN2O5 — CID 66177412
3-[(3-fluoro-4-methoxyphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66177412) has the molecular formula C12H15FN2O5 and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methoxyphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(3-fluoro-4-methoxyphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66177412 |
| Molecular Formula | C12H15FN2O5 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[(3-fluoro-4-methoxyphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | COc1ccc(NC(=O)NCC(C)(O)C(=O)O)cc1F |
| InChI | InChI=1S/C12H15FN2O5/c1-12(19,10(16)17)6-14-11(18)15-7-3-4-9(20-2)8(13)5-7/h3-5,19H,6H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | QFQIGAYSJIQVHY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |