C14H19ClN2O5 — CID 122077131
3-[(3-chloro-4-propoxyphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122077131) has the molecular formula C14H19ClN2O5 and a molecular weight of 330.77 g/mol. Its IUPAC name is 3-[(3-chloro-4-propoxyphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(3-chloro-4-propoxyphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122077131 |
| Molecular Formula | C14H19ClN2O5 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-[(3-chloro-4-propoxyphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CCCOc1ccc(NC(=O)NCC(C)(O)C(=O)O)cc1Cl |
| InChI | InChI=1S/C14H19ClN2O5/c1-3-6-22-11-5-4-9(7-10(11)15)17-13(20)16-8-14(2,21)12(18)19/h4-5,7,21H,3,6,8H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | UYGOMESJTJYBKE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |