C16H25ClN2O3 — CID 111473934
1-(3-chloro-4-propoxyphenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea (PubChem CID 111473934) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is 1-(3-chloro-4-propoxyphenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea.
| Compound Name | 1-(3-chloro-4-propoxyphenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111473934 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-(3-chloro-4-propoxyphenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea |
| SMILES | CCCOc1ccc(NC(=O)NCC(C)(C)CCO)cc1Cl |
| InChI | InChI=1S/C16H25ClN2O3/c1-4-9-22-14-6-5-12(10-13(14)17)19-15(21)18-11-16(2,3)7-8-20/h5-6,10,20H,4,7-9,11H2,1-3H3,(H2,18,19,21) |
| InChIKey | QJNFZDHZXZNJIO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |