C15H25BrN2O2 — CID 66180608
2-N-[(4-bromophenyl)methyl]-4,4-dimethoxy-2-N,2-dimethylbutane-1,2-diamine (PubChem CID 66180608) has the molecular formula C15H25BrN2O2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 2-N-[(4-bromophenyl)methyl]-4,4-dimethoxy-2-N,2-dimethylbutane-1,2-diamine.
| Compound Name | 2-N-[(4-bromophenyl)methyl]-4,4-dimethoxy-2-N,2-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 66180608 |
| Molecular Formula | C15H25BrN2O2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-N-[(4-bromophenyl)methyl]-4,4-dimethoxy-2-N,2-dimethylbutane-1,2-diamine |
| SMILES | COC(CC(C)(CN)N(C)Cc1ccc(Br)cc1)OC |
| InChI | InChI=1S/C15H25BrN2O2/c1-15(11-17,9-14(19-3)20-4)18(2)10-12-5-7-13(16)8-6-12/h5-8,14H,9-11,17H2,1-4H3 |
| InChIKey | PGAYPUOOUTZUIO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|