C15H25FN2O2 — CID 66180018
2-N-ethyl-2-N-(2-fluorophenyl)-4,4-dimethoxy-2-methylbutane-1,2-diamine (PubChem CID 66180018) has the molecular formula C15H25FN2O2 and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-N-ethyl-2-N-(2-fluorophenyl)-4,4-dimethoxy-2-methylbutane-1,2-diamine.
| Compound Name | 2-N-ethyl-2-N-(2-fluorophenyl)-4,4-dimethoxy-2-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 66180018 |
| Molecular Formula | C15H25FN2O2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-N-ethyl-2-N-(2-fluorophenyl)-4,4-dimethoxy-2-methylbutane-1,2-diamine |
| SMILES | CCN(c1ccccc1F)C(C)(CN)CC(OC)OC |
| InChI | InChI=1S/C15H25FN2O2/c1-5-18(13-9-7-6-8-12(13)16)15(2,11-17)10-14(19-3)20-4/h6-9,14H,5,10-11,17H2,1-4H3 |
| InChIKey | DKMSIJBVAFWHHD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|